548-39-0 Perinaphthenone
| Nome del prodotto |
Perinaphthenone |
| Nome inglese |
Perinaphthenone; phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
| Formula molecolare |
C13H8O |
| Peso Molecolare |
180.202 |
| InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| Numero CAS |
548-39-0 |
| EINECS |
208-945-2 |
| Struttura molecolare |
|
| Densità |
1.265g/cm3 |
| Punto di fusione |
149-154℃ |
| Punto di ebollizione |
355.2°C at 760 mmHg |
| Indice di rifrazione |
1.715 |
| Punto d'infiammabilità |
157.9°C |
| Pressione di vapore |
3.18E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|