5391-30-0 2-Bromophenylthiourea
| ürün Ad? |
2-Bromophenylthiourea |
| ingilizce ad? |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| Moleküler Formülü |
C7H7BrN2S |
| Molekül A??rl??? |
231.1129 |
| InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS kay?t numaras? |
5391-30-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.728g/cm3 |
| Kaynama noktas? |
314.2°C at 760 mmHg |
| K?r?lma indisi |
1.748 |
| Alevlenme noktas? |
143.8°C |
| Buhar bas?nc? |
0.000474mmHg at 25°C |
| Risk Kodlar? |
R25:Toxic if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|