5391-30-0 2-Bromophenylthiourea
| Nazwa produktu: |
2-Bromophenylthiourea |
| Angielska nazwa |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| MF |
C7H7BrN2S |
| Masie cz?steczkowej |
231.1129 |
| InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Nr CAS |
5391-30-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.728g/cm3 |
| Temperatura wrzenia |
314.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.748 |
| Temperatura zap?onu |
143.8°C |
| Ci?nienie pary |
0.000474mmHg at 25°C |
| Kody ryzyka |
R25:Toxic if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|