5391-30-0 2-Bromophenylthiourea
| Naam product |
2-Bromophenylthiourea |
| Engelse naam |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| MF |
C7H7BrN2S |
| Molecuulgewicht |
231.1129 |
| InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS-nummer |
5391-30-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.728g/cm3 |
| Kookpunt |
314.2°C at 760 mmHg |
| Brekingsindex |
1.748 |
| Vlampunt |
143.8°C |
| Dampdruk |
0.000474mmHg at 25°C |
| Risico-codes |
R25:Toxic if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|