ChemNet > CAS > 5153-68-4 trans-4-methyl-beta-nitrostyrene
5153-68-4 trans-4-methyl-beta-nitrostyrene
| ürün Ad? |
trans-4-methyl-beta-nitrostyrene |
| ingilizce ad? |
trans-4-methyl-beta-nitrostyrene; 1-(4-Methylphenyl)-2-nitroethylene~1-(p-Tolyl)-2-nitroethylene; 1-methyl-4-[(E)-2-nitroethenyl]benzene |
| Moleküler Formülü |
C9H9NO2 |
| Molekül A??rl??? |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3/b7-6+ |
| CAS kay?t numaras? |
5153-68-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.141g/cm3 |
| Ergime noktas? |
102-104℃ |
| Kaynama noktas? |
275.017°C at 760 mmHg |
| K?r?lma indisi |
1.592 |
| Alevlenme noktas? |
124.924°C |
| Buhar bas?nc? |
0.009mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|