ChemNet > CAS > 5153-68-4 trans-4-methyl-beta-nitrostyrene
5153-68-4 trans-4-methyl-beta-nitrostyrene
| název vyrobku |
trans-4-methyl-beta-nitrostyrene |
| Anglicky název |
trans-4-methyl-beta-nitrostyrene; 1-(4-Methylphenyl)-2-nitroethylene~1-(p-Tolyl)-2-nitroethylene; 1-methyl-4-[(E)-2-nitroethenyl]benzene |
| Molekulární vzorec |
C9H9NO2 |
| Molekulová hmotnost |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3/b7-6+ |
| Registra?ní ?íslo CAS |
5153-68-4 |
| Molekulární struktura |
|
| Hustota |
1.141g/cm3 |
| Bod tání |
102-104℃ |
| Bod varu |
275.017°C at 760 mmHg |
| Index lomu |
1.592 |
| Bod vzplanutí |
124.924°C |
| Tlak par |
0.009mmHg at 25°C |
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|