ChemNet > CAS > 5153-68-4 trans-4-methyl-beta-nitrostyrene
5153-68-4 trans-4-methyl-beta-nitrostyrene
| Produkt-Name |
trans-4-methyl-beta-nitrostyrene |
| Englischer Name |
trans-4-methyl-beta-nitrostyrene; 1-(4-Methylphenyl)-2-nitroethylene~1-(p-Tolyl)-2-nitroethylene; 1-methyl-4-[(E)-2-nitroethenyl]benzene |
| Molekulare Formel |
C9H9NO2 |
| Molecular Weight |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3/b7-6+ |
| CAS Registry Number |
5153-68-4 |
| Molecular Structure |
|
| Dichte |
1.141g/cm3 |
| Schmelzpunkt |
102-104℃ |
| Siedepunkt |
275.017°C at 760 mmHg |
| Brechungsindex |
1.592 |
| Flammpunkt |
124.924°C |
| Dampfdruck |
0.009mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|