ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| ürün Ad? |
2-Iodophenylacetonitrile |
| ingilizce ad? |
2-Iodophenylacetonitrile; 2-Iodobenzyl cyanide |
| Moleküler Formülü |
C8H6IN |
| Molekül A??rl??? |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| CAS kay?t numaras? |
40400-15-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.764g/cm3 |
| Kaynama noktas? |
306°C at 760 mmHg |
| K?r?lma indisi |
1.624 |
| Alevlenme noktas? |
138.8°C |
| Buhar bas?nc? |
0.000795mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|