ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| Nazwa produktu: |
2-Iodophenylacetonitrile |
| Angielska nazwa |
2-Iodophenylacetonitrile; 2-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Masie cz?steczkowej |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| Nr CAS |
40400-15-5 |
| Struktury molekularnej |
|
| G?sto?? |
1.764g/cm3 |
| Temperatura wrzenia |
306°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.624 |
| Temperatura zap?onu |
138.8°C |
| Ci?nienie pary |
0.000795mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|