ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| Ονομασ?α του προ??ντο? |
2-Iodophenylacetonitrile |
| Αγγλικ? ?νομα |
2-Iodophenylacetonitrile; 2-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Μοριακ? β?ρο? |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| CAS ΟΧΙ |
40400-15-5 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.764g/cm3 |
| Σημε?ο βρασμο? |
306°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.624 |
| Σημε?ο αν?φλεξη? |
138.8°C |
| Π?εση ατμ?ν |
0.000795mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S36/37:Wear suitable protective clothing and gloves.;
|
|