ChemNet > CAS > 299-26-3 DL-alpha-Methyltryptamine
299-26-3 DL-alpha-Methyltryptamine
| ürün Ad? |
DL-alpha-Methyltryptamine |
| ingilizce ad? |
DL-alpha-Methyltryptamine; |
| Moleküler Formülü |
C11H15N2 |
| Molekül A??rl??? |
175.2497 |
| InChI |
InChI=1/C11H14N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6,12H2,1H3/p+1/t8-/m1/s1 |
| CAS kay?t numaras? |
299-26-3 |
| EINECS |
206-073-7 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
97-101℃ |
| Kaynama noktas? |
344.5°C at 760 mmHg |
| Alevlenme noktas? |
189°C |
| Buhar bas?nc? |
6.55E-05mmHg at 25°C |
| Tehlike Sembolleri |
T+:Very toxic;
|
| Risk Kodlar? |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|