ChemNet > CAS > 299-26-3 DL-alpha-Methyltryptamine
299-26-3 DL-alpha-Methyltryptamine
| Nama produk |
DL-alpha-Methyltryptamine |
| Nama bahasa Inggris |
DL-alpha-Methyltryptamine; |
| MF |
C11H15N2 |
| Berat Molekul |
175.2497 |
| InChI |
InChI=1/C11H14N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6,12H2,1H3/p+1/t8-/m1/s1 |
| CAS NO |
299-26-3 |
| EINECS |
206-073-7 |
| Struktur Molekul |
|
| Titik lebur |
97-101℃ |
| Titik didih |
344.5°C at 760 mmHg |
| Titik nyala |
189°C |
| Tekanan uap |
6.55E-05mmHg at 25°C |
| Simbol bahaya |
T+:Very toxic;
|
| Kode Risiko |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|