ChemNet > CAS > 299-26-3 DL-alpha-Methyltryptamine
299-26-3 DL-alpha-Methyltryptamine
| Nome del prodotto |
DL-alpha-Methyltryptamine |
| Nome inglese |
DL-alpha-Methyltryptamine; |
| Formula molecolare |
C11H15N2 |
| Peso Molecolare |
175.2497 |
| InChI |
InChI=1/C11H14N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6,12H2,1H3/p+1/t8-/m1/s1 |
| Numero CAS |
299-26-3 |
| EINECS |
206-073-7 |
| Struttura molecolare |
|
| Punto di fusione |
97-101℃ |
| Punto di ebollizione |
344.5°C at 760 mmHg |
| Punto d'infiammabilità |
189°C |
| Pressione di vapore |
6.55E-05mmHg at 25°C |
| Simboli di pericolo |
T+:Very toxic;
|
| Codici di Rischio |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|