2510-55-6 9-Cyanophenanthrene
| ürün Ad? |
9-Cyanophenanthrene |
| ingilizce ad? |
9-Cyanophenanthrene; Cyanophenanthrene; phenanthrene-9-carbonitrile |
| Moleküler Formülü |
C15H9N |
| Molekül A??rl??? |
203.2387 |
| InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
| CAS kay?t numaras? |
2510-55-6 |
| EINECS |
219-725-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.2g/cm3 |
| Ergime noktas? |
110-112℃ |
| Kaynama noktas? |
413.8°C at 760 mmHg |
| K?r?lma indisi |
1.719 |
| Alevlenme noktas? |
205.4°C |
| Buhar bas?nc? |
4.67E-07mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|