2510-55-6 9-Cyanophenanthrene
| Naam product |
9-Cyanophenanthrene |
| Engelse naam |
9-Cyanophenanthrene; Cyanophenanthrene; phenanthrene-9-carbonitrile |
| MF |
C15H9N |
| Molecuulgewicht |
203.2387 |
| InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
| CAS-nummer |
2510-55-6 |
| EINECS |
219-725-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.2g/cm3 |
| Smeltpunt |
110-112℃ |
| Kookpunt |
413.8°C at 760 mmHg |
| Brekingsindex |
1.719 |
| Vlampunt |
205.4°C |
| Dampdruk |
4.67E-07mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|