2510-55-6 9-Cyanophenanthrene
| termék neve |
9-Cyanophenanthrene |
| Angol név |
9-Cyanophenanthrene; Cyanophenanthrene; phenanthrene-9-carbonitrile |
| MF |
C15H9N |
| Molekulat?meg |
203.2387 |
| InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
| CAS-szám |
2510-55-6 |
| EINECS |
219-725-0 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.2g/cm3 |
| Olvadáspont |
110-112℃ |
| Forráspont |
413.8°C at 760 mmHg |
| T?résmutató |
1.719 |
| Gyulladáspont |
205.4°C |
| G?znyomás |
4.67E-07mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|