2425-85-6 Toluidine Red
| ürün Ad? |
Toluidine Red |
| ingilizce ad? |
Toluidine Red; C.I. 12120; C.I. Pigment Red 3; 1-(4-Methyl-2-nitrophenylazo)-2-naphthol; Pigment Red 3; 1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1Z)-1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one |
| Moleküler Formülü |
C17H13N3O3 |
| Molekül A??rl??? |
307.3034 |
| InChI |
InChI=1/C17H13N3O3/c1-11-6-8-14(15(10-11)20(22)23)18-19-17-13-5-3-2-4-12(13)7-9-16(17)21/h2-10,18H,1H3/b19-17- |
| CAS kay?t numaras? |
2425-85-6 |
| EINECS |
219-372-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.32g/cm3 |
| Ergime noktas? |
270-272℃ |
| Kaynama noktas? |
491.9°C at 760 mmHg |
| K?r?lma indisi |
1.66 |
| Alevlenme noktas? |
251.3°C |
| Buhar bas?nc? |
8.02E-10mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|