2425-85-6 Toluidine Red
| Nama produk |
Toluidine Red |
| Nama Inggeris |
Toluidine Red; C.I. 12120; C.I. Pigment Red 3; 1-(4-Methyl-2-nitrophenylazo)-2-naphthol; Pigment Red 3; 1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1Z)-1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one |
| MF |
C17H13N3O3 |
| Berat Molekul |
307.3034 |
| InChI |
InChI=1/C17H13N3O3/c1-11-6-8-14(15(10-11)20(22)23)18-19-17-13-5-3-2-4-12(13)7-9-16(17)21/h2-10,18H,1H3/b19-17- |
| CAS NO |
2425-85-6 |
| EINECS |
219-372-2 |
| Struktur Molekul |
|
| Kepadatan |
1.32g/cm3 |
| Titik lebur |
270-272℃ |
| Titik didih |
491.9°C at 760 mmHg |
| Indeks bias |
1.66 |
| Titik nyala |
251.3°C |
| Tekanan wap |
8.02E-10mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R40:Possible risks of irreversible effects.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|