2425-85-6 Toluidine Red
| produktnavn |
Toluidine Red |
| Engelsk navn |
Toluidine Red; C.I. 12120; C.I. Pigment Red 3; 1-(4-Methyl-2-nitrophenylazo)-2-naphthol; Pigment Red 3; 1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1Z)-1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one |
| Molekyl?r Formel |
C17H13N3O3 |
| Molekylvekt |
307.3034 |
| InChI |
InChI=1/C17H13N3O3/c1-11-6-8-14(15(10-11)20(22)23)18-19-17-13-5-3-2-4-12(13)7-9-16(17)21/h2-10,18H,1H3/b19-17- |
| CAS-nummer |
2425-85-6 |
| EINECS |
219-372-2 |
| Molecular Structure |
|
| Tetthet |
1.32g/cm3 |
| Smeltepunkt |
270-272℃ |
| Kokepunkt |
491.9°C at 760 mmHg |
| Brytningsindeks |
1.66 |
| Flammepunktet |
251.3°C |
| Damptrykk |
8.02E-10mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R40:Possible risks of irreversible effects.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|