229-87-8 Phenanthridine
| ürün Ad? |
Phenanthridine |
| ingilizce ad? |
Phenanthridine; Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| Moleküler Formülü |
C13H9N |
| Molekül A??rl??? |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS kay?t numaras? |
229-87-8 |
| EINECS |
205-934-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.187g/cm3 |
| Ergime noktas? |
104-107℃ |
| Kaynama noktas? |
340.8°C at 760 mmHg |
| K?r?lma indisi |
1.726 |
| Alevlenme noktas? |
155.9°C |
| Buhar bas?nc? |
0.000166mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|