229-87-8 Phenanthridine
| Ονομασ?α του προ??ντο? |
Phenanthridine |
| Αγγλικ? ?νομα |
Phenanthridine; Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| MF |
C13H9N |
| Μοριακ? β?ρο? |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS ΟΧΙ |
229-87-8 |
| EINECS |
205-934-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.187g/cm3 |
| Σημε?ο τ?ξη? |
104-107℃ |
| Σημε?ο βρασμο? |
340.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.726 |
| Σημε?ο αν?φλεξη? |
155.9°C |
| Π?εση ατμ?ν |
0.000166mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|