229-87-8 Phenanthridine
| ?????? ?? ??? |
Phenanthridine |
| ???????? ??? |
Phenanthridine; Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| ????? ???????? |
C13H9N |
| ?????? ??? |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| ??? ??????? ?????? |
229-87-8 |
| EINECS |
205-934-4 |
| ????? ?????? |
|
| ????? |
1.187g/cm3 |
| ?????? |
104-107℃ |
| ????? ?? ??? |
340.8°C at 760 mmHg |
| ??????? ??????? |
1.726 |
| ????? ??????? |
155.9°C |
| ????? ?? ???? |
0.000166mmHg at 25°C |
| ???? ?????? |
Xn:Harmful;
|
| ???? ?? ??? |
R40:Possible risks of irreversible effects.;
|
| ??????? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|