2142-70-3 2-Iodoacetophenone
| ürün Ad? |
2-Iodoacetophenone |
| ingilizce ad? |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
| Moleküler Formülü |
C8H7IO |
| Molekül A??rl??? |
246.045 |
| InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| CAS kay?t numaras? |
2142-70-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.72g/cm3 |
| Kaynama noktas? |
268.2°C at 760 mmHg |
| K?r?lma indisi |
1.603 |
| Alevlenme noktas? |
116°C |
| Buhar bas?nc? |
0.00779mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|