2142-70-3 2-Iodoacetophenone
| Nome do produto |
2-Iodoacetophenone |
| Nome em inglês |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
| Fórmula molecular |
C8H7IO |
| Peso Molecular |
246.045 |
| InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| CAS Registry Number |
2142-70-3 |
| Estrutura Molecular |
|
| Densidade |
1.72g/cm3 |
| Ponto de ebuli??o |
268.2°C at 760 mmHg |
| índice de refra??o |
1.603 |
| O ponto de inflama??o |
116°C |
| Press?o de vapor |
0.00779mmHg at 25°C |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|