2142-70-3 2-Iodoacetophenone
| Nom |
2-Iodoacetophenone |
| Nom anglais |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
| Formule moléculaire |
C8H7IO |
| Poids Moléculaire |
246.045 |
| InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| Numéro de registre CAS |
2142-70-3 |
| Structure moléculaire |
|
| Densité |
1.72g/cm3 |
| Point d'ébullition |
268.2°C at 760 mmHg |
| Indice de réfraction |
1.603 |
| Point d'éclair |
116°C |
| Pression de vapeur |
0.00779mmHg at 25°C |
| Codes des risques |
R36/38:Irritating to eyes and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|