1731-79-9 dimethyl dodecanedioate
| ürün Ad? |
dimethyl dodecanedioate |
| ingilizce ad? |
dimethyl dodecanedioate; Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| Moleküler Formülü |
C14H26O4 |
| Molekül A??rl??? |
258.3538 |
| InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| CAS kay?t numaras? |
1731-79-9 |
| EINECS |
217-050-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.969g/cm3 |
| Kaynama noktas? |
300.9°C at 760 mmHg |
| K?r?lma indisi |
1.441 |
| Alevlenme noktas? |
135°C |
| Buhar bas?nc? |
0.00109mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|