1731-79-9 dimethyl dodecanedioate
| Ονομασ?α του προ??ντο? |
dimethyl dodecanedioate |
| Αγγλικ? ?νομα |
dimethyl dodecanedioate; Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| MF |
C14H26O4 |
| Μοριακ? β?ρο? |
258.3538 |
| InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| CAS ΟΧΙ |
1731-79-9 |
| EINECS |
217-050-6 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.969g/cm3 |
| Σημε?ο βρασμο? |
300.9°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.441 |
| Σημε?ο αν?φλεξη? |
135°C |
| Π?εση ατμ?ν |
0.00109mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|