1731-79-9 dimethyl dodecanedioate
| Nome do produto |
dimethyl dodecanedioate |
| Nome em inglês |
dimethyl dodecanedioate; Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| Fórmula molecular |
C14H26O4 |
| Peso Molecular |
258.3538 |
| InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| CAS Registry Number |
1731-79-9 |
| EINECS |
217-050-6 |
| Estrutura Molecular |
|
| Densidade |
0.969g/cm3 |
| Ponto de ebuli??o |
300.9°C at 760 mmHg |
| índice de refra??o |
1.441 |
| O ponto de inflama??o |
135°C |
| Press?o de vapor |
0.00109mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|