139-87-7 N-Ethyldiethanolamine
| ürün Ad? |
N-Ethyldiethanolamine |
| ingilizce ad? |
N-Ethyldiethanolamine; 2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
| Moleküler Formülü |
C6H16NO2 |
| Molekül A??rl??? |
134.1962 |
| InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
| CAS kay?t numaras? |
139-87-7 |
| EINECS |
205-379-8 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
-50℃ |
| Kaynama noktas? |
246.4°C at 760 mmHg |
| Alevlenme noktas? |
123.9°C |
| Buhar bas?nc? |
0.00449mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|