139-87-7 N-Ethyldiethanolamine
| Nazwa produktu: |
N-Ethyldiethanolamine |
| Angielska nazwa |
N-Ethyldiethanolamine; 2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
| MF |
C6H16NO2 |
| Masie cz?steczkowej |
134.1962 |
| InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
| Nr CAS |
139-87-7 |
| EINECS |
205-379-8 |
| Struktury molekularnej |
|
| Temperatura topnienia |
-50℃ |
| Temperatura wrzenia |
246.4°C at 760 mmHg |
| Temperatura zap?onu |
123.9°C |
| Ci?nienie pary |
0.00449mmHg at 25°C |
| Symbole zagro?enia |
Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|