139-87-7 N-Ethyldiethanolamine
| produktnavn |
N-Ethyldiethanolamine |
| Engelsk navn |
N-Ethyldiethanolamine; 2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
| Molekyl?r Formel |
C6H16NO2 |
| Molekylvekt |
134.1962 |
| InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
| CAS-nummer |
139-87-7 |
| EINECS |
205-379-8 |
| Molecular Structure |
|
| Smeltepunkt |
-50℃ |
| Kokepunkt |
246.4°C at 760 mmHg |
| Flammepunktet |
123.9°C |
| Damptrykk |
0.00449mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|