124-10-7 Methyl myristate
| ürün Ad? |
Methyl myristate |
| ingilizce ad? |
Methyl myristate; Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
| Moleküler Formülü |
C15H30O2 |
| Molekül A??rl??? |
242.40 |
| InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
| CAS kay?t numaras? |
124-10-7 |
| EINECS |
204-680-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.863 |
| Ergime noktas? |
18.4-20℃ |
| Kaynama noktas? |
323℃ |
| K?r?lma indisi |
1.434-1.438 |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|