124-10-7 Methyl myristate
| Naam product |
Methyl myristate |
| Engelse naam |
Methyl myristate; Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
| MF |
C15H30O2 |
| Molecuulgewicht |
242.40 |
| InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
| CAS-nummer |
124-10-7 |
| EINECS |
204-680-1 |
| Moleculaire Structuur |
|
| Dichtheid |
0.863 |
| Smeltpunt |
18.4-20℃ |
| Kookpunt |
323℃ |
| Brekingsindex |
1.434-1.438 |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|