124-10-7 Methyl myristate
| Produkt-Name |
Methyl myristate |
| Englischer Name |
Methyl myristate; Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
| Molekulare Formel |
C15H30O2 |
| Molecular Weight |
242.40 |
| InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
| CAS Registry Number |
124-10-7 |
| EINECS |
204-680-1 |
| Molecular Structure |
|
| Dichte |
0.863 |
| Schmelzpunkt |
18.4-20℃ |
| Siedepunkt |
323℃ |
| Brechungsindex |
1.434-1.438 |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|