1198-55-6 Tetrachloropyrocatechol
| ürün Ad? |
Tetrachloropyrocatechol |
| ingilizce ad? |
Tetrachloropyrocatechol; Tetrachlorocatechol; 3,4,5,6-tetrachlorobenzene-1,2-diol |
| Moleküler Formülü |
C6H2Cl4O2 |
| Molekül A??rl??? |
247.8909 |
| InChI |
InChI=1/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| CAS kay?t numaras? |
1198-55-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.848g/cm3 |
| Kaynama noktas? |
309.1°C at 760 mmHg |
| K?r?lma indisi |
1.661 |
| Alevlenme noktas? |
140.7°C |
| Buhar bas?nc? |
0.000358mmHg at 25°C |
| Risk Kodlar? |
R20/22:Harmful by inhalation and if swallowed.;
R41:Risks of serious damage to eyes.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|