1198-55-6 Tetrachloropyrocatechol
| Produkt-Name |
Tetrachloropyrocatechol |
| Englischer Name |
Tetrachloropyrocatechol; Tetrachlorocatechol; 3,4,5,6-tetrachlorobenzene-1,2-diol |
| Molekulare Formel |
C6H2Cl4O2 |
| Molecular Weight |
247.8909 |
| InChI |
InChI=1/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| CAS Registry Number |
1198-55-6 |
| Molecular Structure |
|
| Dichte |
1.848g/cm3 |
| Siedepunkt |
309.1°C at 760 mmHg |
| Brechungsindex |
1.661 |
| Flammpunkt |
140.7°C |
| Dampfdruck |
0.000358mmHg at 25°C |
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R41:Risks of serious damage to eyes.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|