1198-55-6 Tetrachloropyrocatechol
| Nome do produto |
Tetrachloropyrocatechol |
| Nome em inglês |
Tetrachloropyrocatechol; Tetrachlorocatechol; 3,4,5,6-tetrachlorobenzene-1,2-diol |
| Fórmula molecular |
C6H2Cl4O2 |
| Peso Molecular |
247.8909 |
| InChI |
InChI=1/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| CAS Registry Number |
1198-55-6 |
| Estrutura Molecular |
|
| Densidade |
1.848g/cm3 |
| Ponto de ebuli??o |
309.1°C at 760 mmHg |
| índice de refra??o |
1.661 |
| O ponto de inflama??o |
140.7°C |
| Press?o de vapor |
0.000358mmHg at 25°C |
| Códigos de risco |
R20/22:Harmful by inhalation and if swallowed.;
R41:Risks of serious damage to eyes.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|