1146-65-2 Naphthalene-d8
| ürün Ad? |
Naphthalene-d8 |
| ingilizce ad? |
Naphthalene-d8; |
| Moleküler Formülü |
C10D8 |
| Molekül A??rl??? |
136.2198 |
| InChI |
InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| CAS kay?t numaras? |
1146-65-2 |
| EINECS |
214-552-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.102g/cm3 |
| Ergime noktas? |
81-83℃ |
| Kaynama noktas? |
221.5°C at 760 mmHg |
| K?r?lma indisi |
1.632 |
| Alevlenme noktas? |
78.9°C |
| Buhar bas?nc? |
0.159mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|