1146-65-2 Naphthalene-d8
| product Name |
Naphthalene-d8 |
| CAS No |
1146-65-2 |
| Molecular Formula |
C10D8 |
| Molecular Weight |
136.2198 |
| InChI |
InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| EINECS |
214-552-7 |
| Molecular Structure |
|
| Density |
1.102g/cm3 |
| Melting point |
81-83℃ |
| Boiling point |
221.5°C at 760 mmHg |
| Refractive index |
1.632 |
| Flash point |
78.9°C |
| Vapour Pressur |
0.159mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Zhang |
| Telephone |
+86-21-58956006 |
| Email |
info@abotto.com |
| Address |
Room 303 Building 5 Hengyue Life Square Lane 1111 Miaojing Road Pudong China |