1146-65-2 Naphthalene-d8
| Nome do produto |
Naphthalene-d8 |
| Nome em inglês |
Naphthalene-d8; |
| Fórmula molecular |
C10D8 |
| Peso Molecular |
136.2198 |
| InChI |
InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| CAS Registry Number |
1146-65-2 |
| EINECS |
214-552-7 |
| Estrutura Molecular |
|
| Densidade |
1.102g/cm3 |
| Ponto de fus?o |
81-83℃ |
| Ponto de ebuli??o |
221.5°C at 760 mmHg |
| índice de refra??o |
1.632 |
| O ponto de inflama??o |
78.9°C |
| Press?o de vapor |
0.159mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S36/37:Wear suitable protective clothing and gloves.;
|
|