112-61-8 Methyl stearate
| ürün Ad? |
Methyl stearate |
| ingilizce ad? |
Methyl stearate; Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| Moleküler Formülü |
C19H38O2 |
| Molekül A??rl??? |
298.5038 |
| InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| CAS kay?t numaras? |
112-61-8 |
| EINECS |
203-990-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.863g/cm3 |
| Ergime noktas? |
37-39℃ |
| Kaynama noktas? |
355.5°C at 760 mmHg |
| K?r?lma indisi |
1.444 |
| Alevlenme noktas? |
169.3°C |
| Buhar bas?nc? |
3.11E-05mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|