112-61-8 Methyl stearate
| Nama produk |
Methyl stearate |
| Nama bahasa Inggris |
Methyl stearate; Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| MF |
C19H38O2 |
| Berat Molekul |
298.5038 |
| InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| CAS NO |
112-61-8 |
| EINECS |
203-990-4 |
| Struktur Molekul |
|
| Kepadatan |
0.863g/cm3 |
| Titik lebur |
37-39℃ |
| Titik didih |
355.5°C at 760 mmHg |
| Indeks bias |
1.444 |
| Titik nyala |
169.3°C |
| Tekanan uap |
3.11E-05mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|