112-61-8 Methyl stearate
| Nome del prodotto |
Methyl stearate |
| Nome inglese |
Methyl stearate; Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| Formula molecolare |
C19H38O2 |
| Peso Molecolare |
298.5038 |
| InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| Numero CAS |
112-61-8 |
| EINECS |
203-990-4 |
| Struttura molecolare |
|
| Densità |
0.863g/cm3 |
| Punto di fusione |
37-39℃ |
| Punto di ebollizione |
355.5°C at 760 mmHg |
| Indice di rifrazione |
1.444 |
| Punto d'infiammabilità |
169.3°C |
| Pressione di vapore |
3.11E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|