ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
| ürün Ad? |
Triethyleneglycoldiacetate |
| ingilizce ad? |
Triethyleneglycoldiacetate; Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
| Moleküler Formülü |
C10H18O6 |
| Molekül A??rl??? |
234.2463 |
| InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
| CAS kay?t numaras? |
111-21-7 |
| EINECS |
203-846-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.098g/cm3 |
| Kaynama noktas? |
286°C at 760 mmHg |
| K?r?lma indisi |
1.432 |
| Alevlenme noktas? |
125.2°C |
| Buhar bas?nc? |
0.00271mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|