ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
| Nome del prodotto |
Triethyleneglycoldiacetate |
| Nome inglese |
Triethyleneglycoldiacetate; Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
| Formula molecolare |
C10H18O6 |
| Peso Molecolare |
234.2463 |
| InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
| Numero CAS |
111-21-7 |
| EINECS |
203-846-0 |
| Struttura molecolare |
|
| Densità |
1.098g/cm3 |
| Punto di ebollizione |
286°C at 760 mmHg |
| Indice di rifrazione |
1.432 |
| Punto d'infiammabilità |
125.2°C |
| Pressione di vapore |
0.00271mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|