ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
| produktnavn |
Triethyleneglycoldiacetate |
| Engelsk navn |
Triethyleneglycoldiacetate; Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
| Molekyl?r Formel |
C10H18O6 |
| Molekylvekt |
234.2463 |
| InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
| CAS-nummer |
111-21-7 |
| EINECS |
203-846-0 |
| Molecular Structure |
|
| Tetthet |
1.098g/cm3 |
| Kokepunkt |
286°C at 760 mmHg |
| Brytningsindeks |
1.432 |
| Flammepunktet |
125.2°C |
| Damptrykk |
0.00271mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|