110-36-1 butyl myristate
| ürün Ad? |
butyl myristate |
| ingilizce ad? |
butyl myristate; n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
| Moleküler Formülü |
C18H36O2 |
| Molekül A??rl??? |
284.4772 |
| InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
| CAS kay?t numaras? |
110-36-1 |
| EINECS |
203-759-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.864g/cm3 |
| Kaynama noktas? |
334.7°C at 760 mmHg |
| K?r?lma indisi |
1.442 |
| Alevlenme noktas? |
158.5°C |
| Buhar bas?nc? |
0.000126mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|