110-36-1 butyl myristate
| Naam product |
butyl myristate |
| Engelse naam |
butyl myristate; n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
| MF |
C18H36O2 |
| Molecuulgewicht |
284.4772 |
| InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
| CAS-nummer |
110-36-1 |
| EINECS |
203-759-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.864g/cm3 |
| Kookpunt |
334.7°C at 760 mmHg |
| Brekingsindex |
1.442 |
| Vlampunt |
158.5°C |
| Dampdruk |
0.000126mmHg at 25°C |
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|