110-36-1 butyl myristate
| název vyrobku |
butyl myristate |
| Anglicky název |
butyl myristate; n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
| Molekulární vzorec |
C18H36O2 |
| Molekulová hmotnost |
284.4772 |
| InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
| Registra?ní ?íslo CAS |
110-36-1 |
| EINECS |
203-759-8 |
| Molekulární struktura |
|
| Hustota |
0.864g/cm3 |
| Bod varu |
334.7°C at 760 mmHg |
| Index lomu |
1.442 |
| Bod vzplanutí |
158.5°C |
| Tlak par |
0.000126mmHg at 25°C |
| Riziko Codes |
R36/38:Irritating to eyes and skin.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|