ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
| ürün Ad? |
Ethyl hydrogen glutarate |
| ingilizce ad? |
Ethyl hydrogen glutarate; Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate; 5-ethoxy-5-keto-valeric acid |
| Moleküler Formülü |
C7H12O4 |
| Molekül A??rl??? |
160.1678 |
| InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| CAS kay?t numaras? |
1070-62-8 |
| EINECS |
213-977-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.126g/cm3 |
| Kaynama noktas? |
280°C at 760 mmHg |
| K?r?lma indisi |
1.444 |
| Alevlenme noktas? |
112.5°C |
| Buhar bas?nc? |
0.00103mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|